C24H36F3NO6SSi — CID 10697944
benzyl (2S,3R)-2-methyl-6-(trifluoromethylsulfonyloxy)-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 10697944) has the molecular formula C24H36F3NO6SSi and a molecular weight of 551.70 g/mol. Its IUPAC name is benzyl (2S,3R)-2-methyl-6-(trifluoromethylsulfonyloxy)-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | benzyl (2S,3R)-2-methyl-6-(trifluoromethylsulfonyloxy)-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 10697944 |
| Molecular Formula | C24H36F3NO6SSi |
| Molecular Weight | 551.70 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | benzyl (2S,3R)-2-methyl-6-(trifluoromethylsulfonyloxy)-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)[Si](O[C@@H]1CC=C(OS(=O)(=O)C(F)(F)F)N(C(=O)OCc2ccccc2)[C@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H36F3NO6SSi/c1-16(2)36(17(3)4,18(5)6)34-21-13-14-22(33-35(30,31)24(25,26)27)28(19(21)7)23(29)32-15-20-11-9-8-10-12-20/h8-12,14,16-19,21H,13,15H2,1-7H3/t19-,21+/m0/s1 |
| InChIKey | UATINASXCLFXJO-PZJWPPBQSA-N |
| XLogP | 6.69 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.70 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|