C14H17Br3N2O — CID 106979653
3-propan-2-yl-N-(2,4,6-tribromophenyl)pyrrolidine-3-carboxamide (PubChem CID 106979653) has the molecular formula C14H17Br3N2O and a molecular weight of 469.02 g/mol. Its IUPAC name is 3-propan-2-yl-N-(2,4,6-tribromophenyl)pyrrolidine-3-carboxamide.
| Compound Name | 3-propan-2-yl-N-(2,4,6-tribromophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106979653 |
| Molecular Formula | C14H17Br3N2O |
| Molecular Weight | 469.02 g/mol |
| Exact Mass | 465.89 |
| IUPAC Name | 3-propan-2-yl-N-(2,4,6-tribromophenyl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)C1(C(=O)Nc2c(Br)cc(Br)cc2Br)CCNC1 |
| InChI | InChI=1S/C14H17Br3N2O/c1-8(2)14(3-4-18-7-14)13(20)19-12-10(16)5-9(15)6-11(12)17/h5-6,8,18H,3-4,7H2,1-2H3,(H,19,20) |
| InChIKey | CWONCMAAHNPXDG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.02 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |