C16H24N2OS — CID 106980005
N-(2-ethylsulfanylphenyl)-3-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 106980005) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is N-(2-ethylsulfanylphenyl)-3-propan-2-ylpyrrolidine-3-carboxamide.
| Compound Name | N-(2-ethylsulfanylphenyl)-3-propan-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106980005 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-(2-ethylsulfanylphenyl)-3-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | CCSc1ccccc1NC(=O)C1(C(C)C)CCNC1 |
| InChI | InChI=1S/C16H24N2OS/c1-4-20-14-8-6-5-7-13(14)18-15(19)16(12(2)3)9-10-17-11-16/h5-8,12,17H,4,9-11H2,1-3H3,(H,18,19) |
| InChIKey | JHPKIOPJNLFPMG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |