C16H24N2O2 — CID 107863282
N-[(1R)-2-hydroxy-1-phenylethyl]-3-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 107863282) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-[(1R)-2-hydroxy-1-phenylethyl]-3-propan-2-ylpyrrolidine-3-carboxamide.
| Compound Name | N-[(1R)-2-hydroxy-1-phenylethyl]-3-propan-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 107863282 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N-[(1R)-2-hydroxy-1-phenylethyl]-3-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | CC(C)C1(C(=O)N[C@@H](CO)c2ccccc2)CCNC1 |
| InChI | InChI=1S/C16H24N2O2/c1-12(2)16(8-9-17-11-16)15(20)18-14(10-19)13-6-4-3-5-7-13/h3-7,12,14,17,19H,8-11H2,1-2H3,(H,18,20)/t14-,16?/m0/s1 |
| InChIKey | DNRFUNGZJGNYAY-LBAUFKAWSA-N |
| XLogP | 1.47 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |