C17H25ClN2O — CID 106979821
N-[1-(3-chlorophenyl)propyl]-3-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 106979821) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)propyl]-3-propan-2-ylpyrrolidine-3-carboxamide.
| Compound Name | N-[1-(3-chlorophenyl)propyl]-3-propan-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106979821 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-[1-(3-chlorophenyl)propyl]-3-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | CCC(NC(=O)C1(C(C)C)CCNC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H25ClN2O/c1-4-15(13-6-5-7-14(18)10-13)20-16(21)17(12(2)3)8-9-19-11-17/h5-7,10,12,15,19H,4,8-9,11H2,1-3H3,(H,20,21) |
| InChIKey | VHYOEYYHUVOXDD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |