C12H23F3N2 — CID 106981968
4,4,4-trifluoro-N-[(3-propan-2-ylpyrrolidin-3-yl)methyl]butan-1-amine (PubChem CID 106981968) has the molecular formula C12H23F3N2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[(3-propan-2-ylpyrrolidin-3-yl)methyl]butan-1-amine.
| Compound Name | 4,4,4-trifluoro-N-[(3-propan-2-ylpyrrolidin-3-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 106981968 |
| Molecular Formula | C12H23F3N2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 4,4,4-trifluoro-N-[(3-propan-2-ylpyrrolidin-3-yl)methyl]butan-1-amine |
| SMILES | CC(C)C1(CNCCCC(F)(F)F)CCNC1 |
| InChI | InChI=1S/C12H23F3N2/c1-10(2)11(5-7-17-9-11)8-16-6-3-4-12(13,14)15/h10,16-17H,3-9H2,1-2H3 |
| InChIKey | CGYVFRMNRBUWKJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|