C11H19ClF3N — CID 115518503
N-[[1-(chloromethyl)cyclopentyl]methyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 115518503) has the molecular formula C11H19ClF3N and a molecular weight of 257.73 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclopentyl]methyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[[1-(chloromethyl)cyclopentyl]methyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 115518503 |
| Molecular Formula | C11H19ClF3N |
| Molecular Weight | 257.73 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[[1-(chloromethyl)cyclopentyl]methyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | FC(F)(F)CCCNCC1(CCl)CCCC1 |
| InChI | InChI=1S/C11H19ClF3N/c12-8-10(4-1-2-5-10)9-16-7-3-6-11(13,14)15/h16H,1-9H2 |
| InChIKey | FJLPGJKQCIVEOO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.73 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|