C9H16ClF2N — CID 115363272
N-[[1-(chloromethyl)cyclopentyl]methyl]-2,2-difluoroethanamine (PubChem CID 115363272) has the molecular formula C9H16ClF2N and a molecular weight of 211.68 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclopentyl]methyl]-2,2-difluoroethanamine.
| Compound Name | N-[[1-(chloromethyl)cyclopentyl]methyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 115363272 |
| Molecular Formula | C9H16ClF2N |
| Molecular Weight | 211.68 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | N-[[1-(chloromethyl)cyclopentyl]methyl]-2,2-difluoroethanamine |
| SMILES | FC(F)CNCC1(CCl)CCCC1 |
| InChI | InChI=1S/C9H16ClF2N/c10-6-9(3-1-2-4-9)7-13-5-8(11)12/h8,13H,1-7H2 |
| InChIKey | CDXOIYVWRXCUNN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.68 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|