C8H14ClF2N — CID 65025598
1-(chloromethyl)-N-(2,2-difluoroethyl)cyclopentan-1-amine (PubChem CID 65025598) has the molecular formula C8H14ClF2N and a molecular weight of 197.66 g/mol. Its IUPAC name is 1-(chloromethyl)-N-(2,2-difluoroethyl)cyclopentan-1-amine.
| Compound Name | 1-(chloromethyl)-N-(2,2-difluoroethyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 65025598 |
| Molecular Formula | C8H14ClF2N |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 1-(chloromethyl)-N-(2,2-difluoroethyl)cyclopentan-1-amine |
| SMILES | FC(F)CNC1(CCl)CCCC1 |
| InChI | InChI=1S/C8H14ClF2N/c9-6-8(3-1-2-4-8)12-5-7(10)11/h7,12H,1-6H2 |
| InChIKey | UAVGVGYGNUERPA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|