C16H23FN2O2 — CID 106984629
1-[1-(5-fluoro-2-pyridinyl)propyl]-3-propan-2-ylpyrrolidine-3-carboxylic acid (PubChem CID 106984629) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is 1-[1-(5-fluoro-2-pyridinyl)propyl]-3-propan-2-ylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[1-(5-fluoro-2-pyridinyl)propyl]-3-propan-2-ylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 106984629 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-[1-(5-fluoro-2-pyridinyl)propyl]-3-propan-2-ylpyrrolidine-3-carboxylic acid |
| SMILES | CCC(c1ccc(F)cn1)N1CCC(C(=O)O)(C(C)C)C1 |
| InChI | InChI=1S/C16H23FN2O2/c1-4-14(13-6-5-12(17)9-18-13)19-8-7-16(10-19,11(2)3)15(20)21/h5-6,9,11,14H,4,7-8,10H2,1-3H3,(H,20,21) |
| InChIKey | XAFJXPMVZJENON-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |