C18H27NO2 — CID 106984643
1-(1-phenylbutan-2-yl)-3-propan-2-ylpyrrolidine-3-carboxylic acid (PubChem CID 106984643) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-(1-phenylbutan-2-yl)-3-propan-2-ylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(1-phenylbutan-2-yl)-3-propan-2-ylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 106984643 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 1-(1-phenylbutan-2-yl)-3-propan-2-ylpyrrolidine-3-carboxylic acid |
| SMILES | CCC(Cc1ccccc1)N1CCC(C(=O)O)(C(C)C)C1 |
| InChI | InChI=1S/C18H27NO2/c1-4-16(12-15-8-6-5-7-9-15)19-11-10-18(13-19,14(2)3)17(20)21/h5-9,14,16H,4,10-13H2,1-3H3,(H,20,21) |
| InChIKey | FQHUIOYBSLNXHQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |