C16H25NO2S — CID 106984782
1-(2-methyl-1-thiophen-2-ylpropyl)-3-propan-2-ylpyrrolidine-3-carboxylic acid (PubChem CID 106984782) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is 1-(2-methyl-1-thiophen-2-ylpropyl)-3-propan-2-ylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2-methyl-1-thiophen-2-ylpropyl)-3-propan-2-ylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 106984782 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 1-(2-methyl-1-thiophen-2-ylpropyl)-3-propan-2-ylpyrrolidine-3-carboxylic acid |
| SMILES | CC(C)C(c1cccs1)N1CCC(C(=O)O)(C(C)C)C1 |
| InChI | InChI=1S/C16H25NO2S/c1-11(2)14(13-6-5-9-20-13)17-8-7-16(10-17,12(3)4)15(18)19/h5-6,9,11-12,14H,7-8,10H2,1-4H3,(H,18,19) |
| InChIKey | ZTCIMWRZCMDLHS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |