C16H21Cl2N — CID 106984988
5,7-dichloro-3-octyl-1H-indole (PubChem CID 106984988) has the molecular formula C16H21Cl2N and a molecular weight of 298.26 g/mol. Its IUPAC name is 5,7-dichloro-3-octyl-1H-indole.
| Compound Name | 5,7-dichloro-3-octyl-1H-indole |
|---|---|
| PubChem CID | 106984988 |
| Molecular Formula | C16H21Cl2N |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 5,7-dichloro-3-octyl-1H-indole |
| SMILES | CCCCCCCCc1c[nH]c2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C16H21Cl2N/c1-2-3-4-5-6-7-8-12-11-19-16-14(12)9-13(17)10-15(16)18/h9-11,19H,2-8H2,1H3 |
| InChIKey | FJPLBDRNHLHASM-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|