C14H18ClN — CID 106985998
5-chloro-3-(cyclopentylmethyl)-2,3-dihydro-1H-indole (PubChem CID 106985998) has the molecular formula C14H18ClN and a molecular weight of 235.76 g/mol. Its IUPAC name is 5-chloro-3-(cyclopentylmethyl)-2,3-dihydro-1H-indole.
| Compound Name | 5-chloro-3-(cyclopentylmethyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106985998 |
| Molecular Formula | C14H18ClN |
| Molecular Weight | 235.76 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 5-chloro-3-(cyclopentylmethyl)-2,3-dihydro-1H-indole |
| SMILES | Clc1ccc2c(c1)C(CC1CCCC1)CN2 |
| InChI | InChI=1S/C14H18ClN/c15-12-5-6-14-13(8-12)11(9-16-14)7-10-3-1-2-4-10/h5-6,8,10-11,16H,1-4,7,9H2 |
| InChIKey | UJWSGNPKULBXEA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.76 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |