C13H15F2N — CID 106986352
3-(cyclobutylmethyl)-5,7-difluoro-2,3-dihydro-1H-indole (PubChem CID 106986352) has the molecular formula C13H15F2N and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-(cyclobutylmethyl)-5,7-difluoro-2,3-dihydro-1H-indole.
| Compound Name | 3-(cyclobutylmethyl)-5,7-difluoro-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106986352 |
| Molecular Formula | C13H15F2N |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-(cyclobutylmethyl)-5,7-difluoro-2,3-dihydro-1H-indole |
| SMILES | Fc1cc(F)c2c(c1)C(CC1CCC1)CN2 |
| InChI | InChI=1S/C13H15F2N/c14-10-5-11-9(4-8-2-1-3-8)7-16-13(11)12(15)6-10/h5-6,8-9,16H,1-4,7H2 |
| InChIKey | AMKHYPJRZYULDV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |