C9H9F2N — CID 106986066
5,7-difluoro-3-methyl-2,3-dihydro-1H-indole (PubChem CID 106986066) has the molecular formula C9H9F2N and a molecular weight of 169.17 g/mol. Its IUPAC name is 5,7-difluoro-3-methyl-2,3-dihydro-1H-indole.
| Compound Name | 5,7-difluoro-3-methyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106986066 |
| Molecular Formula | C9H9F2N |
| Molecular Weight | 169.17 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 5,7-difluoro-3-methyl-2,3-dihydro-1H-indole |
| SMILES | CC1CNc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C9H9F2N/c1-5-4-12-9-7(5)2-6(10)3-8(9)11/h2-3,5,12H,4H2,1H3 |
| InChIKey | ZKIVQLOTRODZHT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.17 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |