About 5,7-difluoro-3-hexyl-2,3-dihydro-1H-indole
5,7-difluoro-3-hexyl-2,3-dihydro-1H-indole (PubChem CID 106985694) has the molecular formula C14H19F2N
and a molecular weight of 239.31 g/mol. Its IUPAC name is 5,7-difluoro-3-hexyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5,7-difluoro-3-hexyl-2,3-dihydro-1H-indole |
| PubChem CID | 106985694 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 5,7-difluoro-3-hexyl-2,3-dihydro-1H-indole |
| SMILES | CCCCCCC1CNc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C14H19F2N/c1-2-3-4-5-6-10-9-17-14-12(10)7-11(15)8-13(14)16/h7-8,10,17H,2-6,9H2,1H3 |
| InChIKey | XHJKBPICJKORME-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,7-difluoro-3-hexyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-difluoro-3-hexyl-2,3-dihydro-1H-indole?
The IUPAC name of 5,7-difluoro-3-hexyl-2,3-dihydro-1H-indole (CID 106985694) is 5,7-difluoro-3-hexyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 5,7-difluoro-3-hexyl-2,3-dihydro-1H-indole?
The canonical SMILES for 5,7-difluoro-3-hexyl-2,3-dihydro-1H-indole is CCCCCCC1CNc2c(F)cc(F)cc21.
What is the InChIKey of 5,7-difluoro-3-hexyl-2,3-dihydro-1H-indole?
The InChIKey is XHJKBPICJKORME-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F2N/c1-2-3-4-5-6-10-9-17-14-12(10)7-11(15)8-13(14)16/h7-8,10,17H,2-6,9H2,1H3.
What are the key properties of 5,7-difluoro-3-hexyl-2,3-dihydro-1H-indole?
5,7-difluoro-3-hexyl-2,3-dihydro-1H-indole has a molecular weight of 239.31 g/mol, XLogP of 4.44, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-difluoro-3-hexyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 106985694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).