C13H17Cl2N — CID 106985724
5,7-dichloro-3-pentyl-2,3-dihydro-1H-indole (PubChem CID 106985724) has the molecular formula C13H17Cl2N and a molecular weight of 258.19 g/mol. Its IUPAC name is 5,7-dichloro-3-pentyl-2,3-dihydro-1H-indole.
| Compound Name | 5,7-dichloro-3-pentyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106985724 |
| Molecular Formula | C13H17Cl2N |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 5,7-dichloro-3-pentyl-2,3-dihydro-1H-indole |
| SMILES | CCCCCC1CNc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C13H17Cl2N/c1-2-3-4-5-9-8-16-13-11(9)6-10(14)7-12(13)15/h6-7,9,16H,2-5,8H2,1H3 |
| InChIKey | VHLBIRHYRDZPAF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|