C9H9Cl2NO — CID 83917330
(5,7-dichloro-2,3-dihydro-1H-indol-3-yl)methanol (PubChem CID 83917330) has the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. Its IUPAC name is (5,7-dichloro-2,3-dihydro-1H-indol-3-yl)methanol.
| Compound Name | (5,7-dichloro-2,3-dihydro-1H-indol-3-yl)methanol |
|---|---|
| PubChem CID | 83917330 |
| Molecular Formula | C9H9Cl2NO |
| Molecular Weight | 218.08 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | (5,7-dichloro-2,3-dihydro-1H-indol-3-yl)methanol |
| SMILES | OCC1CNc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C9H9Cl2NO/c10-6-1-7-5(4-13)3-12-9(7)8(11)2-6/h1-2,5,12-13H,3-4H2 |
| InChIKey | METOPSVTVFOJRM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.08 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |