C12H11Cl2NO — CID 22462444
6,8-dichloro-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinolin-4-one (PubChem CID 22462444) has the molecular formula C12H11Cl2NO and a molecular weight of 256.13 g/mol. Its IUPAC name is 6,8-dichloro-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinolin-4-one.
| Compound Name | 6,8-dichloro-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinolin-4-one |
|---|---|
| PubChem CID | 22462444 |
| Molecular Formula | C12H11Cl2NO |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 6,8-dichloro-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinolin-4-one |
| SMILES | O=C1Nc2c(Cl)cc(Cl)cc2C2CCCC12 |
| InChI | InChI=1S/C12H11Cl2NO/c13-6-4-9-7-2-1-3-8(7)12(16)15-11(9)10(14)5-6/h4-5,7-8H,1-3H2,(H,15,16) |
| InChIKey | KVTRXNABKYWGDH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |