C12H13Cl2N — CID 106986327
5,7-dichloro-3-cyclobutyl-2,3-dihydro-1H-indole (PubChem CID 106986327) has the molecular formula C12H13Cl2N and a molecular weight of 242.15 g/mol. Its IUPAC name is 5,7-dichloro-3-cyclobutyl-2,3-dihydro-1H-indole.
| Compound Name | 5,7-dichloro-3-cyclobutyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106986327 |
| Molecular Formula | C12H13Cl2N |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 5,7-dichloro-3-cyclobutyl-2,3-dihydro-1H-indole |
| SMILES | Clc1cc(Cl)c2c(c1)C(C1CCC1)CN2 |
| InChI | InChI=1S/C12H13Cl2N/c13-8-4-9-10(7-2-1-3-7)6-15-12(9)11(14)5-8/h4-5,7,10,15H,1-3,6H2 |
| InChIKey | UZRXAMVCDVFUGN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |