C9H10ClFN2 — CID 131050920
8-chloro-6-fluoro-1,2,3,4-tetrahydroquinolin-4-amine (PubChem CID 131050920) has the molecular formula C9H10ClFN2 and a molecular weight of 200.64 g/mol. Its IUPAC name is 8-chloro-6-fluoro-1,2,3,4-tetrahydroquinolin-4-amine.
| Compound Name | 8-chloro-6-fluoro-1,2,3,4-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 131050920 |
| Molecular Formula | C9H10ClFN2 |
| Molecular Weight | 200.64 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 8-chloro-6-fluoro-1,2,3,4-tetrahydroquinolin-4-amine |
| SMILES | NC1CCNc2c(Cl)cc(F)cc21 |
| InChI | InChI=1S/C9H10ClFN2/c10-7-4-5(11)3-6-8(12)1-2-13-9(6)7/h3-4,8,13H,1-2,12H2 |
| InChIKey | YPNKUCQSBLCXAD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.64 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |