C17H19ClFN5O — CID 145408245
(8-chloro-6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)-(3,5-diamino-4,5,6,7-tetrahydroindazol-2-yl)methanone (PubChem CID 145408245) has the molecular formula C17H19ClFN5O and a molecular weight of 363.82 g/mol. Its IUPAC name is (8-chloro-6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)-(3,5-diamino-4,5,6,7-tetrahydroindazol-2-yl)methanone.
| Compound Name | (8-chloro-6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)-(3,5-diamino-4,5,6,7-tetrahydroindazol-2-yl)methanone |
|---|---|
| PubChem CID | 145408245 |
| Molecular Formula | C17H19ClFN5O |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | (8-chloro-6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)-(3,5-diamino-4,5,6,7-tetrahydroindazol-2-yl)methanone |
| SMILES | Nc1c2c(nn1C(=O)C1CCNc3c(Cl)cc(F)cc31)CCC(N)C2 |
| InChI | InChI=1S/C17H19ClFN5O/c18-13-6-8(19)5-11-10(3-4-22-15(11)13)17(25)24-16(21)12-7-9(20)1-2-14(12)23-24/h5-6,9-10,22H,1-4,7,20-21H2 |
| InChIKey | OLXQPIQHFHQREI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |