C19H24FN5O — CID 147174400
(3-amino-6-propyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone (PubChem CID 147174400) has the molecular formula C19H24FN5O and a molecular weight of 357.43 g/mol. Its IUPAC name is (3-amino-6-propyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone.
| Compound Name | (3-amino-6-propyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 147174400 |
| Molecular Formula | C19H24FN5O |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | (3-amino-6-propyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
| SMILES | CCCN1CCc2c(nn(C(=O)C3CCNc4ccc(F)cc43)c2N)C1 |
| InChI | InChI=1S/C19H24FN5O/c1-2-8-24-9-6-14-17(11-24)23-25(18(14)21)19(26)13-5-7-22-16-4-3-12(20)10-15(13)16/h3-4,10,13,22H,2,5-9,11,21H2,1H3 |
| InChIKey | BYIVOTSAQOTIOU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |