C18H22FN5O4S — CID 155330708
(3-amino-6-methylsulfonyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-8-methoxy-1,2,3,4-tetrahydroquinolin-4-yl)methanone (PubChem CID 155330708) has the molecular formula C18H22FN5O4S and a molecular weight of 423.47 g/mol. Its IUPAC name is (3-amino-6-methylsulfonyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-8-methoxy-1,2,3,4-tetrahydroquinolin-4-yl)methanone.
| Compound Name | (3-amino-6-methylsulfonyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-8-methoxy-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 155330708 |
| Molecular Formula | C18H22FN5O4S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (3-amino-6-methylsulfonyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-8-methoxy-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
| SMILES | COc1cc(F)cc2c1NCCC2C(=O)n1nc2c(c1N)CCN(S(C)(=O)=O)C2 |
| InChI | InChI=1S/C18H22FN5O4S/c1-28-15-8-10(19)7-13-11(3-5-21-16(13)15)18(25)24-17(20)12-4-6-23(29(2,26)27)9-14(12)22-24/h7-8,11,21H,3-6,9,20H2,1-2H3 |
| InChIKey | ZCQNEHRDORRYEZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |