C20H29FN4O2 — CID 145408187
(3-amino-4,5,6,7-tetrahydroindazol-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone;ethane;methanol (PubChem CID 145408187) has the molecular formula C20H29FN4O2 and a molecular weight of 376.48 g/mol. Its IUPAC name is (3-amino-4,5,6,7-tetrahydroindazol-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone;ethane;methanol.
| Compound Name | (3-amino-4,5,6,7-tetrahydroindazol-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone;ethane;methanol |
|---|---|
| PubChem CID | 145408187 |
| Molecular Formula | C20H29FN4O2 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | (3-amino-4,5,6,7-tetrahydroindazol-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone;ethane;methanol |
| SMILES | CC.CO.Nc1c2c(nn1C(=O)C1CCNc3ccc(F)cc31)CCCC2 |
| InChI | InChI=1S/C17H19FN4O.C2H6.CH4O/c18-10-5-6-14-13(9-10)11(7-8-20-14)17(23)22-16(19)12-3-1-2-4-15(12)21-22;2*1-2/h5-6,9,11,20H,1-4,7-8,19H2;1-2H3;2H,1H3 |
| InChIKey | FFTCENXZHDLDCL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |