C18H23N5O — CID 138708019
[(6R)-3,6-diamino-4,5,6,7-tetrahydroindazol-2-yl]-(6-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanone (PubChem CID 138708019) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is [(6R)-3,6-diamino-4,5,6,7-tetrahydroindazol-2-yl]-(6-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanone.
| Compound Name | [(6R)-3,6-diamino-4,5,6,7-tetrahydroindazol-2-yl]-(6-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 138708019 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | [(6R)-3,6-diamino-4,5,6,7-tetrahydroindazol-2-yl]-(6-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
| SMILES | Cc1ccc2c(c1)C(C(=O)n1nc3c(c1N)CC[C@@H](N)C3)CCN2 |
| InChI | InChI=1S/C18H23N5O/c1-10-2-5-15-14(8-10)12(6-7-21-15)18(24)23-17(20)13-4-3-11(19)9-16(13)22-23/h2,5,8,11-12,21H,3-4,6-7,9,19-20H2,1H3/t11-,12?/m1/s1 |
| InChIKey | FWSBTUISHCZORC-JHJMLUEUSA-N |
| XLogP | 1.83 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |