C16H17ClIN4O- — CID 163691758
CID 163691758 (PubChem CID 163691758) has the molecular formula C16H17ClIN4O- and a molecular weight of 443.70 g/mol.
| Compound Name | CID 163691758 |
|---|---|
| PubChem CID | 163691758 |
| Molecular Formula | C16H17ClIN4O- |
| Molecular Weight | 443.70 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | — |
| SMILES | Nc1c2c(nn1C(=O)[C@@H]1CCNc3c(Cl)cccc31)CC[I-]C2 |
| InChI | InChI=1S/C16H17ClIN4O/c17-12-3-1-2-9-10(5-7-20-14(9)12)16(23)22-15(19)11-8-18-6-4-13(11)21-22/h1-3,10,20H,4-8,19H2/q-1/t10-/m1/s1 |
| InChIKey | OQWFGUWLLHFNSF-SNVBAGLBSA-N |
| XLogP | -0.50 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.70 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|