C16H21NO2 — CID 82184556
8-cyclohexyl-3,6,7,8-tetrahydro-2H-[1,4]dioxino[2,3-f]indole (PubChem CID 82184556) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 8-cyclohexyl-3,6,7,8-tetrahydro-2H-[1,4]dioxino[2,3-f]indole.
| Compound Name | 8-cyclohexyl-3,6,7,8-tetrahydro-2H-[1,4]dioxino[2,3-f]indole |
|---|---|
| PubChem CID | 82184556 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 8-cyclohexyl-3,6,7,8-tetrahydro-2H-[1,4]dioxino[2,3-f]indole |
| SMILES | c1c2c(cc3c1OCCO3)C(C1CCCCC1)CN2 |
| InChI | InChI=1S/C16H21NO2/c1-2-4-11(5-3-1)13-10-17-14-9-16-15(8-12(13)14)18-6-7-19-16/h8-9,11,13,17H,1-7,10H2 |
| InChIKey | WFPHBHYAFWPXFM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|