C15H22N2O2 — CID 82156575
7-methyl-6-(2-methylpropyl)-3,7,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinoxaline (PubChem CID 82156575) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 7-methyl-6-(2-methylpropyl)-3,7,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinoxaline.
| Compound Name | 7-methyl-6-(2-methylpropyl)-3,7,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinoxaline |
|---|---|
| PubChem CID | 82156575 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 7-methyl-6-(2-methylpropyl)-3,7,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinoxaline |
| SMILES | CC(C)CN1c2cc3c(cc2NCC1C)OCCO3 |
| InChI | InChI=1S/C15H22N2O2/c1-10(2)9-17-11(3)8-16-12-6-14-15(7-13(12)17)19-5-4-18-14/h6-7,10-11,16H,4-5,8-9H2,1-3H3 |
| InChIKey | LADDZNMKJOWVFP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|