C12H13NO4 — CID 82276242
2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]quinoline-9-carboxylic acid (PubChem CID 82276242) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]quinoline-9-carboxylic acid.
| Compound Name | 2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]quinoline-9-carboxylic acid |
|---|---|
| PubChem CID | 82276242 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]quinoline-9-carboxylic acid |
| SMILES | O=C(O)C1CCNc2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C12H13NO4/c14-12(15)7-1-2-13-9-6-11-10(5-8(7)9)16-3-4-17-11/h5-7,13H,1-4H2,(H,14,15) |
| InChIKey | FPWBVQLBEHOMNS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|