C18H27F2N — CID 106986208
3-decyl-5,7-difluoro-2,3-dihydro-1H-indole (PubChem CID 106986208) has the molecular formula C18H27F2N and a molecular weight of 295.42 g/mol. Its IUPAC name is 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole.
| Compound Name | 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106986208 |
| Molecular Formula | C18H27F2N |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole |
| SMILES | CCCCCCCCCCC1CNc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C18H27F2N/c1-2-3-4-5-6-7-8-9-10-14-13-21-18-16(14)11-15(19)12-17(18)20/h11-12,14,21H,2-10,13H2,1H3 |
| InChIKey | WETJIEJGKYJUHA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|