About 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole
3-decyl-5,7-difluoro-2,3-dihydro-1H-indole (PubChem CID 106986208) has the molecular formula C18H27F2N
and a molecular weight of 295.42 g/mol. Its IUPAC name is 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole |
| PubChem CID | 106986208 |
| Molecular Formula | C18H27F2N |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole |
| SMILES | CCCCCCCCCCC1CNc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C18H27F2N/c1-2-3-4-5-6-7-8-9-10-14-13-21-18-16(14)11-15(19)12-17(18)20/h11-12,14,21H,2-10,13H2,1H3 |
| InChIKey | WETJIEJGKYJUHA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole?
The IUPAC name of 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole (CID 106986208) is 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole.
What is the SMILES notation for 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole?
The canonical SMILES for 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole is CCCCCCCCCCC1CNc2c(F)cc(F)cc21.
What is the InChIKey of 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole?
The InChIKey is WETJIEJGKYJUHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27F2N/c1-2-3-4-5-6-7-8-9-10-14-13-21-18-16(14)11-15(19)12-17(18)20/h11-12,14,21H,2-10,13H2,1H3.
What are the key properties of 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole?
3-decyl-5,7-difluoro-2,3-dihydro-1H-indole has a molecular weight of 295.42 g/mol, XLogP of 6.00, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-decyl-5,7-difluoro-2,3-dihydro-1H-indole is sourced from PubChem (CID 106986208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).