C35H41N3O6 — CID 10698813
(2R)-2-[[(3R,5S)-4-acetyl-3-(1-adamantylmethyl)-1-benzyl-2,7-dioxo-5,6-dihydro-3H-1,4-benzodiazonine-5-carbonyl]amino]propanoic acid (PubChem CID 10698813) has the molecular formula C35H41N3O6 and a molecular weight of 599.73 g/mol. Its IUPAC name is (2R)-2-[[(3R,5S)-4-acetyl-3-(1-adamantylmethyl)-1-benzyl-2,7-dioxo-5,6-dihydro-3H-1,4-benzodiazonine-5-carbonyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(3R,5S)-4-acetyl-3-(1-adamantylmethyl)-1-benzyl-2,7-dioxo-5,6-dihydro-3H-1,4-benzodiazonine-5-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10698813 |
| Molecular Formula | C35H41N3O6 |
| Molecular Weight | 599.73 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | (2R)-2-[[(3R,5S)-4-acetyl-3-(1-adamantylmethyl)-1-benzyl-2,7-dioxo-5,6-dihydro-3H-1,4-benzodiazonine-5-carbonyl]amino]propanoic acid |
| SMILES | CC(=O)N1[C@H](CC23CC4CC(CC(C4)C2)C3)C(=O)N(Cc2ccccc2)c2ccccc2C(=O)C[C@H]1C(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C35H41N3O6/c1-21(34(43)44)36-32(41)29-15-31(40)27-10-6-7-11-28(27)37(20-23-8-4-3-5-9-23)33(42)30(38(29)22(2)39)19-35-16-24-12-25(17-35)14-26(13-24)18-35/h3-11,21,24-26,29-30H,12-20H2,1-2H3,(H,36,41)(H,43,44)/t21-,24?,25?,26?,29+,30-,35?/m1/s1 |
| InChIKey | KSORIHZMEYOFIF-SICGKJMBSA-N |
| XLogP | 4.59 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.73 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |