C34H38ClN3O7 — CID 10604116
2-[[(3S,5R)-3-(1-adamantylmethyl)-1-[(2-chlorophenyl)methyl]-4-methoxycarbonyl-2,7-dioxo-5,6-dihydro-3H-1,4-benzodiazonine-5-carbonyl]amino]acetic acid (PubChem CID 10604116) has the molecular formula C34H38ClN3O7 and a molecular weight of 636.15 g/mol. Its IUPAC name is 2-[[(3S,5R)-3-(1-adamantylmethyl)-1-[(2-chlorophenyl)methyl]-4-methoxycarbonyl-2,7-dioxo-5,6-dihydro-3H-1,4-benzodiazonine-5-carbonyl]amino]acetic acid.
| Compound Name | 2-[[(3S,5R)-3-(1-adamantylmethyl)-1-[(2-chlorophenyl)methyl]-4-methoxycarbonyl-2,7-dioxo-5,6-dihydro-3H-1,4-benzodiazonine-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 10604116 |
| Molecular Formula | C34H38ClN3O7 |
| Molecular Weight | 636.15 g/mol |
| Exact Mass | 635.24 |
| IUPAC Name | 2-[[(3S,5R)-3-(1-adamantylmethyl)-1-[(2-chlorophenyl)methyl]-4-methoxycarbonyl-2,7-dioxo-5,6-dihydro-3H-1,4-benzodiazonine-5-carbonyl]amino]acetic acid |
| SMILES | COC(=O)N1[C@@H](C(=O)NCC(=O)O)CC(=O)c2ccccc2N(Cc2ccccc2Cl)C(=O)[C@@H]1CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C34H38ClN3O7/c1-45-33(44)38-27(31(42)36-18-30(40)41)13-29(39)24-7-3-5-9-26(24)37(19-23-6-2-4-8-25(23)35)32(43)28(38)17-34-14-20-10-21(15-34)12-22(11-20)16-34/h2-9,20-22,27-28H,10-19H2,1H3,(H,36,42)(H,40,41)/t20?,21?,22?,27-,28+,34?/m1/s1 |
| InChIKey | UKZMUSIXKLMSGM-LZLUXTLPSA-N |
| XLogP | 5.07 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.15 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |