C13H20FNO3 — CID 106989211
1-(3-fluoro-4-methylanilino)-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 106989211) has the molecular formula C13H20FNO3 and a molecular weight of 257.30 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylanilino)-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-(3-fluoro-4-methylanilino)-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 106989211 |
| Molecular Formula | C13H20FNO3 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-(3-fluoro-4-methylanilino)-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | COCCOCC(O)CNc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C13H20FNO3/c1-10-3-4-11(7-13(10)14)15-8-12(16)9-18-6-5-17-2/h3-4,7,12,15-16H,5-6,8-9H2,1-2H3 |
| InChIKey | ZRLMVXNOSIQFGY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|