C13H17F4NO3 — CID 106989570
1-[4-fluoro-3-(trifluoromethyl)anilino]-3-(2-methoxyethoxy)propan-2-ol (PubChem CID 106989570) has the molecular formula C13H17F4NO3 and a molecular weight of 311.28 g/mol. Its IUPAC name is 1-[4-fluoro-3-(trifluoromethyl)anilino]-3-(2-methoxyethoxy)propan-2-ol.
| Compound Name | 1-[4-fluoro-3-(trifluoromethyl)anilino]-3-(2-methoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 106989570 |
| Molecular Formula | C13H17F4NO3 |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-[4-fluoro-3-(trifluoromethyl)anilino]-3-(2-methoxyethoxy)propan-2-ol |
| SMILES | COCCOCC(O)CNc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F4NO3/c1-20-4-5-21-8-10(19)7-18-9-2-3-12(14)11(6-9)13(15,16)17/h2-3,6,10,18-19H,4-5,7-8H2,1H3 |
| InChIKey | WXSVZZAEMSEXCX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|