C14H19ClF3NO2 — CID 60899678
1-[4-chloro-3-(trifluoromethyl)anilino]-3-(2-methylpropoxy)propan-2-ol (PubChem CID 60899678) has the molecular formula C14H19ClF3NO2 and a molecular weight of 325.76 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)anilino]-3-(2-methylpropoxy)propan-2-ol.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)anilino]-3-(2-methylpropoxy)propan-2-ol |
|---|---|
| PubChem CID | 60899678 |
| Molecular Formula | C14H19ClF3NO2 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)anilino]-3-(2-methylpropoxy)propan-2-ol |
| SMILES | CC(C)COCC(O)CNc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19ClF3NO2/c1-9(2)7-21-8-11(20)6-19-10-3-4-13(15)12(5-10)14(16,17)18/h3-5,9,11,19-20H,6-8H2,1-2H3 |
| InChIKey | XVIVVHGETFUTHI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |