C14H17F4NO2 — CID 61228034
1-(cyclopropylmethoxy)-3-[4-fluoro-3-(trifluoromethyl)anilino]propan-2-ol (PubChem CID 61228034) has the molecular formula C14H17F4NO2 and a molecular weight of 307.29 g/mol. Its IUPAC name is 1-(cyclopropylmethoxy)-3-[4-fluoro-3-(trifluoromethyl)anilino]propan-2-ol.
| Compound Name | 1-(cyclopropylmethoxy)-3-[4-fluoro-3-(trifluoromethyl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 61228034 |
| Molecular Formula | C14H17F4NO2 |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-(cyclopropylmethoxy)-3-[4-fluoro-3-(trifluoromethyl)anilino]propan-2-ol |
| SMILES | OC(CNc1ccc(F)c(C(F)(F)F)c1)COCC1CC1 |
| InChI | InChI=1S/C14H17F4NO2/c15-13-4-3-10(5-12(13)14(16,17)18)19-6-11(20)8-21-7-9-1-2-9/h3-5,9,11,19-20H,1-2,6-8H2 |
| InChIKey | MFHHNHMHUHDIGU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |