C13H23NO4 — CID 106989853
1-(1-methoxypropan-2-yloxy)-3-[(5-methylfuran-2-yl)methylamino]propan-2-ol (PubChem CID 106989853) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yloxy)-3-[(5-methylfuran-2-yl)methylamino]propan-2-ol.
| Compound Name | 1-(1-methoxypropan-2-yloxy)-3-[(5-methylfuran-2-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 106989853 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-(1-methoxypropan-2-yloxy)-3-[(5-methylfuran-2-yl)methylamino]propan-2-ol |
| SMILES | COCC(C)OCC(O)CNCc1ccc(C)o1 |
| InChI | InChI=1S/C13H23NO4/c1-10-4-5-13(18-10)7-14-6-12(15)9-17-11(2)8-16-3/h4-5,11-12,14-15H,6-9H2,1-3H3 |
| InChIKey | USSWVXBYBNVMPR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 63.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |