C11H21NO6 — CID 106991398
4-[2-hydroxy-3-(2-methoxyethoxy)propyl]morpholine-2-carboxylic acid (PubChem CID 106991398) has the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. Its IUPAC name is 4-[2-hydroxy-3-(2-methoxyethoxy)propyl]morpholine-2-carboxylic acid.
| Compound Name | 4-[2-hydroxy-3-(2-methoxyethoxy)propyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 106991398 |
| Molecular Formula | C11H21NO6 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 4-[2-hydroxy-3-(2-methoxyethoxy)propyl]morpholine-2-carboxylic acid |
| SMILES | COCCOCC(O)CN1CCOC(C(=O)O)C1 |
| InChI | InChI=1S/C11H21NO6/c1-16-4-5-17-8-9(13)6-12-2-3-18-10(7-12)11(14)15/h9-10,13H,2-8H2,1H3,(H,14,15) |
| InChIKey | PSOMGFKSWFOYDL-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|