C13H19BrO3S — CID 106992332
1-(4-bromophenyl)sulfanyl-3-(1-methoxypropan-2-yloxy)propan-2-ol (PubChem CID 106992332) has the molecular formula C13H19BrO3S and a molecular weight of 335.26 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfanyl-3-(1-methoxypropan-2-yloxy)propan-2-ol.
| Compound Name | 1-(4-bromophenyl)sulfanyl-3-(1-methoxypropan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 106992332 |
| Molecular Formula | C13H19BrO3S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 1-(4-bromophenyl)sulfanyl-3-(1-methoxypropan-2-yloxy)propan-2-ol |
| SMILES | COCC(C)OCC(O)CSc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H19BrO3S/c1-10(7-16-2)17-8-12(15)9-18-13-5-3-11(14)4-6-13/h3-6,10,12,15H,7-9H2,1-2H3 |
| InChIKey | VNOHYWCOXMGHCB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |