C13H19FO3S — CID 106992357
1-(2-fluorophenyl)sulfanyl-3-(1-methoxypropan-2-yloxy)propan-2-ol (PubChem CID 106992357) has the molecular formula C13H19FO3S and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfanyl-3-(1-methoxypropan-2-yloxy)propan-2-ol.
| Compound Name | 1-(2-fluorophenyl)sulfanyl-3-(1-methoxypropan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 106992357 |
| Molecular Formula | C13H19FO3S |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(2-fluorophenyl)sulfanyl-3-(1-methoxypropan-2-yloxy)propan-2-ol |
| SMILES | COCC(C)OCC(O)CSc1ccccc1F |
| InChI | InChI=1S/C13H19FO3S/c1-10(7-16-2)17-8-11(15)9-18-13-6-4-3-5-12(13)14/h3-6,10-11,15H,7-9H2,1-2H3 |
| InChIKey | MCOIGECHYSWLBH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |