C14H30N2O3 — CID 106992598
1-[2-(aminomethyl)-3-methylpiperidin-1-yl]-3-(1-methoxypropan-2-yloxy)propan-2-ol (PubChem CID 106992598) has the molecular formula C14H30N2O3 and a molecular weight of 274.40 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-3-methylpiperidin-1-yl]-3-(1-methoxypropan-2-yloxy)propan-2-ol.
| Compound Name | 1-[2-(aminomethyl)-3-methylpiperidin-1-yl]-3-(1-methoxypropan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 106992598 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 1-[2-(aminomethyl)-3-methylpiperidin-1-yl]-3-(1-methoxypropan-2-yloxy)propan-2-ol |
| SMILES | COCC(C)OCC(O)CN1CCCC(C)C1CN |
| InChI | InChI=1S/C14H30N2O3/c1-11-5-4-6-16(14(11)7-15)8-13(17)10-19-12(2)9-18-3/h11-14,17H,4-10,15H2,1-3H3 |
| InChIKey | DNMQFSZZEWNWEQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |