C14H27NO5 — CID 107072174
1-[2-hydroxy-3-(1-methoxypropan-2-yloxy)propyl]-3-methylpiperidine-2-carboxylic acid (PubChem CID 107072174) has the molecular formula C14H27NO5 and a molecular weight of 289.37 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(1-methoxypropan-2-yloxy)propyl]-3-methylpiperidine-2-carboxylic acid.
| Compound Name | 1-[2-hydroxy-3-(1-methoxypropan-2-yloxy)propyl]-3-methylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 107072174 |
| Molecular Formula | C14H27NO5 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 1-[2-hydroxy-3-(1-methoxypropan-2-yloxy)propyl]-3-methylpiperidine-2-carboxylic acid |
| SMILES | COCC(C)OCC(O)CN1CCCC(C)C1C(=O)O |
| InChI | InChI=1S/C14H27NO5/c1-10-5-4-6-15(13(10)14(17)18)7-12(16)9-20-11(2)8-19-3/h10-13,16H,4-9H2,1-3H3,(H,17,18) |
| InChIKey | FZJKCEWPNLXBGI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |