C13H26N4O4 — CID 106993138
1-[4-[(2-methoxyethylamino)methyl]triazol-1-yl]-3-(1-methoxypropan-2-yloxy)propan-2-ol (PubChem CID 106993138) has the molecular formula C13H26N4O4 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-[4-[(2-methoxyethylamino)methyl]triazol-1-yl]-3-(1-methoxypropan-2-yloxy)propan-2-ol.
| Compound Name | 1-[4-[(2-methoxyethylamino)methyl]triazol-1-yl]-3-(1-methoxypropan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 106993138 |
| Molecular Formula | C13H26N4O4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-[4-[(2-methoxyethylamino)methyl]triazol-1-yl]-3-(1-methoxypropan-2-yloxy)propan-2-ol |
| SMILES | COCCNCc1cn(CC(O)COC(C)COC)nn1 |
| InChI | InChI=1S/C13H26N4O4/c1-11(9-20-3)21-10-13(18)8-17-7-12(15-16-17)6-14-4-5-19-2/h7,11,13-14,18H,4-6,8-10H2,1-3H3 |
| InChIKey | UQVOSPISDAIXBX-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|