C15H15Cl2N3O — CID 106993306
2,6-dichloro-N-[4-[(dimethylamino)methyl]phenyl]pyridine-3-carboxamide (PubChem CID 106993306) has the molecular formula C15H15Cl2N3O and a molecular weight of 324.21 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-[(dimethylamino)methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-[4-[(dimethylamino)methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106993306 |
| Molecular Formula | C15H15Cl2N3O |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2,6-dichloro-N-[4-[(dimethylamino)methyl]phenyl]pyridine-3-carboxamide |
| SMILES | CN(C)Cc1ccc(NC(=O)c2ccc(Cl)nc2Cl)cc1 |
| InChI | InChI=1S/C15H15Cl2N3O/c1-20(2)9-10-3-5-11(6-4-10)18-15(21)12-7-8-13(16)19-14(12)17/h3-8H,9H2,1-2H3,(H,18,21) |
| InChIKey | YINUEIZSQFZOEZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|