C12H11Cl2N3O2 — CID 106994233
3-[(2,6-dichloro-3-pyridinyl)methyl]-2-methoxy-6-methylpyrimidin-4-one (PubChem CID 106994233) has the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.15 g/mol. Its IUPAC name is 3-[(2,6-dichloro-3-pyridinyl)methyl]-2-methoxy-6-methylpyrimidin-4-one.
| Compound Name | 3-[(2,6-dichloro-3-pyridinyl)methyl]-2-methoxy-6-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 106994233 |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 3-[(2,6-dichloro-3-pyridinyl)methyl]-2-methoxy-6-methylpyrimidin-4-one |
| SMILES | COc1nc(C)cc(=O)n1Cc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C12H11Cl2N3O2/c1-7-5-10(18)17(12(15-7)19-2)6-8-3-4-9(13)16-11(8)14/h3-5H,6H2,1-2H3 |
| InChIKey | CEIKUKCBINPOLN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|