C14H14N4O2S — CID 106996490
N-(5-amino-3-methyl-2-pyridinyl)-4-cyano-2-methylbenzenesulfonamide (PubChem CID 106996490) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-(5-amino-3-methyl-2-pyridinyl)-4-cyano-2-methylbenzenesulfonamide.
| Compound Name | N-(5-amino-3-methyl-2-pyridinyl)-4-cyano-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106996490 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-(5-amino-3-methyl-2-pyridinyl)-4-cyano-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(C#N)ccc1S(=O)(=O)Nc1ncc(N)cc1C |
| InChI | InChI=1S/C14H14N4O2S/c1-9-5-11(7-15)3-4-13(9)21(19,20)18-14-10(2)6-12(16)8-17-14/h3-6,8H,16H2,1-2H3,(H,17,18) |
| InChIKey | SFWGMKIVXVRRIF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |