C13H15N5O2S — CID 106996486
N-[2-(4-aminopyrazol-1-yl)ethyl]-4-cyano-2-methylbenzenesulfonamide (PubChem CID 106996486) has the molecular formula C13H15N5O2S and a molecular weight of 305.36 g/mol. Its IUPAC name is N-[2-(4-aminopyrazol-1-yl)ethyl]-4-cyano-2-methylbenzenesulfonamide.
| Compound Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-4-cyano-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106996486 |
| Molecular Formula | C13H15N5O2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-4-cyano-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(C#N)ccc1S(=O)(=O)NCCn1cc(N)cn1 |
| InChI | InChI=1S/C13H15N5O2S/c1-10-6-11(7-14)2-3-13(10)21(19,20)17-4-5-18-9-12(15)8-16-18/h2-3,6,8-9,17H,4-5,15H2,1H3 |
| InChIKey | LSBYABMINLMHED-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |