C11H12N6O2S — CID 106593209
N-[2-(4-aminopyrazol-1-yl)ethyl]-2-cyanopyridine-3-sulfonamide (PubChem CID 106593209) has the molecular formula C11H12N6O2S and a molecular weight of 292.32 g/mol. Its IUPAC name is N-[2-(4-aminopyrazol-1-yl)ethyl]-2-cyanopyridine-3-sulfonamide.
| Compound Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-2-cyanopyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106593209 |
| Molecular Formula | C11H12N6O2S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-2-cyanopyridine-3-sulfonamide |
| SMILES | N#Cc1ncccc1S(=O)(=O)NCCn1cc(N)cn1 |
| InChI | InChI=1S/C11H12N6O2S/c12-6-10-11(2-1-3-14-10)20(18,19)16-4-5-17-8-9(13)7-15-17/h1-3,7-8,16H,4-5,13H2 |
| InChIKey | YVXWJDFUOHTHOE-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |